C15H25N5O — CID 69044125
6-[5-(methoxymethyl)octyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 69044125) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is 6-[5-(methoxymethyl)octyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-[5-(methoxymethyl)octyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69044125 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 6-[5-(methoxymethyl)octyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCC(CCCCc1cnc2ncnn2c1N)COC |
| InChI | InChI=1S/C15H25N5O/c1-3-6-12(10-21-2)7-4-5-8-13-9-17-15-18-11-19-20(15)14(13)16/h9,11-12H,3-8,10,16H2,1-2H3 |
| InChIKey | GVPGBQVLNLFVJI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|