About 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one
2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one (PubChem CID 69044333) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one |
| PubChem CID | 69044333 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1CCOC1=O.COCC#N |
| InChI | InChI=1S/C4H7NO2.C3H5NO/c1-5-2-3-7-4(5)6;1-5-3-2-4/h2-3H2,1H3;3H2,1H3 |
| InChIKey | YBJGVQSFODRDPL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one?
The IUPAC name of 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one (CID 69044333) is 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one is CN1CCOC1=O.COCC#N.
What is the InChIKey of 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one?
The InChIKey is YBJGVQSFODRDPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.C3H5NO/c1-5-2-3-7-4(5)6;1-5-3-2-4/h2-3H2,1H3;3H2,1H3.
What are the key properties of 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one?
2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one has a molecular weight of 172.18 g/mol, XLogP of 0.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyacetonitrile;3-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 69044333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).