About sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate
sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate (PubChem CID 69044513) has the molecular formula C17H26NNaO2
and a molecular weight of 299.39 g/mol. Its IUPAC name is sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate.
Molecular Properties
| Compound Name | sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate |
| PubChem CID | 69044513 |
| Molecular Formula | C17H26NNaO2 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate |
| SMILES | CC(C)(C)[O-].CC(C)(C)c1ccccc1N1CCC1=O.[Na+] |
| InChI | InChI=1S/C13H17NO.C4H9O.Na/c1-13(2,3)10-6-4-5-7-11(10)14-9-8-12(14)15;1-4(2,3)5;/h4-7H,8-9H2,1-3H3;1-3H3;/q;-1;+1 |
| InChIKey | YMBMEWUWCKQBSH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate?
The IUPAC name of sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate (CID 69044513) is sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate.
What is the SMILES notation for sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate?
The canonical SMILES for sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate is CC(C)(C)[O-].CC(C)(C)c1ccccc1N1CCC1=O.[Na+].
What is the InChIKey of sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate?
The InChIKey is YMBMEWUWCKQBSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO.C4H9O.Na/c1-13(2,3)10-6-4-5-7-11(10)14-9-8-12(14)15;1-4(2,3)5;/h4-7H,8-9H2,1-3H3;1-3H3;/q;-1;+1.
What are the key properties of sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate?
sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate has a molecular weight of 299.39 g/mol, XLogP of -0.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-(2-tert-butylphenyl)azetidin-2-one;2-methylpropan-2-olate is sourced from PubChem (CID 69044513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).