C17H18O3 — CID 69045239
4,4a,4b,5,6,6a,7,9-octahydro-3H-naphtho[2,1-f]isochromene-1,8-dione (PubChem CID 69045239) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4,4a,4b,5,6,6a,7,9-octahydro-3H-naphtho[2,1-f]isochromene-1,8-dione.
| Compound Name | 4,4a,4b,5,6,6a,7,9-octahydro-3H-naphtho[2,1-f]isochromene-1,8-dione |
|---|---|
| PubChem CID | 69045239 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 4,4a,4b,5,6,6a,7,9-octahydro-3H-naphtho[2,1-f]isochromene-1,8-dione |
| SMILES | O=C1CC=C2C3=CC=C4C(=O)OCCC4C3CCC2C1 |
| InChI | InChI=1S/C17H18O3/c18-11-2-4-12-10(9-11)1-3-14-13(12)5-6-16-15(14)7-8-20-17(16)19/h4-6,10,14-15H,1-3,7-9H2 |
| InChIKey | KKVHIPLXGOERLJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |