About [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide
[2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide (PubChem CID 69045585) has the molecular formula C15H15BrCl3IN4O3
and a molecular weight of 612.48 g/mol. Its IUPAC name is [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide.
Molecular Properties
| Compound Name | [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide |
| PubChem CID | 69045585 |
| Molecular Formula | C15H15BrCl3IN4O3 |
| Molecular Weight | 612.48 g/mol |
| Exact Mass | 609.84 |
| IUPAC Name | [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)NNc1ccc(Cl)c(Oc2cc(Cl)cc(Br)c2Cl)c1[N+](=O)[O-].[I-] |
| InChI | InChI=1S/C15H15BrCl3N4O3.HI/c1-23(2,3)21-20-11-5-4-10(18)15(14(11)22(24)25)26-12-7-8(17)6-9(16)13(12)19;/h4-7,20-21H,1-3H3;1H/q+1;/p-1 |
| InChIKey | YQJUZLRDNROOAZ-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 612.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide?
The IUPAC name of [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide (CID 69045585) is [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide.
What is the SMILES notation for [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide?
The canonical SMILES for [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide is C[N+](C)(C)NNc1ccc(Cl)c(Oc2cc(Cl)cc(Br)c2Cl)c1[N+](=O)[O-].[I-].
What is the InChIKey of [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide?
The InChIKey is YQJUZLRDNROOAZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H15BrCl3N4O3.HI/c1-23(2,3)21-20-11-5-4-10(18)15(14(11)22(24)25)26-12-7-8(17)6-9(16)13(12)19;/h4-7,20-21H,1-3H3;1H/q+1;/p-1.
What are the key properties of [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide?
[2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide has a molecular weight of 612.48 g/mol, XLogP of 2.65, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[3-(3-bromo-2,5-dichlorophenoxy)-4-chloro-2-nitrophenyl]hydrazinyl]-trimethylazanium iodide is sourced from PubChem (CID 69045585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).