pyrimidin-5-amine;2,2,2-trifluoroacetic acid

C6H6F3N3O2 — CID 69046453

IUPACpyrimidin-5-amine;2,2,2-trifluoroacetic acid
SMILESNc1cncnc1.O=C(O)C(F)(F)F
InChIInChI=1S/C4H5N3.C2HF3O2/c5-4-1-6-3-7-2-4;3-2(4,5)1(6)7/h1-3H,5H2;(H,6,7)
InChIKeyAHTBSQOOXCUCBM-UHFFFAOYSA-N
MW209.13 g/mol
LogP0.69
Rot. Bonds

About pyrimidin-5-amine;2,2,2-trifluoroacetic acid

pyrimidin-5-amine;2,2,2-trifluoroacetic acid (PubChem CID 69046453) has the molecular formula C6H6F3N3O2 and a molecular weight of 209.13 g/mol. Its IUPAC name is pyrimidin-5-amine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namepyrimidin-5-amine;2,2,2-trifluoroacetic acid
PubChem CID69046453
Molecular FormulaC6H6F3N3O2
Molecular Weight209.13 g/mol
Exact Mass209.04
IUPAC Namepyrimidin-5-amine;2,2,2-trifluoroacetic acid
SMILESNc1cncnc1.O=C(O)C(F)(F)F
InChIInChI=1S/C4H5N3.C2HF3O2/c5-4-1-6-3-7-2-4;3-2(4,5)1(6)7/h1-3H,5H2;(H,6,7)
InChIKeyAHTBSQOOXCUCBM-UHFFFAOYSA-N
XLogP0.69
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.13
LogP ≤ 50.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze pyrimidin-5-amine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyrimidin-5-amine;2,2,2-trifluoroacetic acid?
The IUPAC name of pyrimidin-5-amine;2,2,2-trifluoroacetic acid (CID 69046453) is pyrimidin-5-amine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for pyrimidin-5-amine;2,2,2-trifluoroacetic acid?
The canonical SMILES for pyrimidin-5-amine;2,2,2-trifluoroacetic acid is Nc1cncnc1.O=C(O)C(F)(F)F.
What is the InChIKey of pyrimidin-5-amine;2,2,2-trifluoroacetic acid?
The InChIKey is AHTBSQOOXCUCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3.C2HF3O2/c5-4-1-6-3-7-2-4;3-2(4,5)1(6)7/h1-3H,5H2;(H,6,7).
What are the key properties of pyrimidin-5-amine;2,2,2-trifluoroacetic acid?
pyrimidin-5-amine;2,2,2-trifluoroacetic acid has a molecular weight of 209.13 g/mol, XLogP of 0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-5-amine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 69046453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).