About pyrimidin-5-amine;2,2,2-trifluoroacetic acid
pyrimidin-5-amine;2,2,2-trifluoroacetic acid (PubChem CID 69046453) has the molecular formula C6H6F3N3O2
and a molecular weight of 209.13 g/mol. Its IUPAC name is pyrimidin-5-amine;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | pyrimidin-5-amine;2,2,2-trifluoroacetic acid |
| PubChem CID | 69046453 |
| Molecular Formula | C6H6F3N3O2 |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | pyrimidin-5-amine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1cncnc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C4H5N3.C2HF3O2/c5-4-1-6-3-7-2-4;3-2(4,5)1(6)7/h1-3H,5H2;(H,6,7) |
| InChIKey | AHTBSQOOXCUCBM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrimidin-5-amine;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidin-5-amine;2,2,2-trifluoroacetic acid?
The IUPAC name of pyrimidin-5-amine;2,2,2-trifluoroacetic acid (CID 69046453) is pyrimidin-5-amine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for pyrimidin-5-amine;2,2,2-trifluoroacetic acid?
The canonical SMILES for pyrimidin-5-amine;2,2,2-trifluoroacetic acid is Nc1cncnc1.O=C(O)C(F)(F)F.
What is the InChIKey of pyrimidin-5-amine;2,2,2-trifluoroacetic acid?
The InChIKey is AHTBSQOOXCUCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3.C2HF3O2/c5-4-1-6-3-7-2-4;3-2(4,5)1(6)7/h1-3H,5H2;(H,6,7).
What are the key properties of pyrimidin-5-amine;2,2,2-trifluoroacetic acid?
pyrimidin-5-amine;2,2,2-trifluoroacetic acid has a molecular weight of 209.13 g/mol, XLogP of 0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidin-5-amine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 69046453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).