C10H20N2 — CID 69046896
1,1,2-trimethyl-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine (PubChem CID 69046896) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1,1,2-trimethyl-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine.
| Compound Name | 1,1,2-trimethyl-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 69046896 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1,1,2-trimethyl-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c]pyrimidine |
| SMILES | CN1CCC2CCCN2C1(C)C |
| InChI | InChI=1S/C10H20N2/c1-10(2)11(3)8-6-9-5-4-7-12(9)10/h9H,4-8H2,1-3H3 |
| InChIKey | SGOMIFOVRLYODE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |