C21H19Cl2N3O3S — CID 6904700
(E)-4-(2,4-dichlorophenyl)-3-[(E)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-N-(2-methoxyethyl)-1,3-thiazol-2-imine (PubChem CID 6904700) has the molecular formula C21H19Cl2N3O3S and a molecular weight of 464.37 g/mol. Its IUPAC name is (E)-4-(2,4-dichlorophenyl)-3-[(E)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-N-(2-methoxyethyl)-1,3-thiazol-2-imine.
| Compound Name | (E)-4-(2,4-dichlorophenyl)-3-[(E)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-N-(2-methoxyethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6904700 |
| Molecular Formula | C21H19Cl2N3O3S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | (E)-4-(2,4-dichlorophenyl)-3-[(E)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-N-(2-methoxyethyl)-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2ccc(Cl)cc2Cl)n1/N=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H19Cl2N3O3S/c1-27-7-6-24-21-26(18(13-30-21)16-4-3-15(22)11-17(16)23)25-12-14-2-5-19-20(10-14)29-9-8-28-19/h2-5,10-13H,6-9H2,1H3/b24-21-,25-12+ |
| InChIKey | IGWXTHZVPPLTCP-STRHTSDCSA-N |
| XLogP | 4.72 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|