About 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol
3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol (PubChem CID 69047064) has the molecular formula C16H20N2O3S
and a molecular weight of 320.41 g/mol. Its IUPAC name is 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol |
| PubChem CID | 69047064 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol |
| SMILES | Cc1ccc(-c2cc(CCCO)nc(S(C)(=O)=O)n2)cc1C |
| InChI | InChI=1S/C16H20N2O3S/c1-11-6-7-13(9-12(11)2)15-10-14(5-4-8-19)17-16(18-15)22(3,20)21/h6-7,9-10,19H,4-5,8H2,1-3H3 |
| InChIKey | UYLBTLGBYRMZBG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol?
The IUPAC name of 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol (CID 69047064) is 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol.
What is the SMILES notation for 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol?
The canonical SMILES for 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol is Cc1ccc(-c2cc(CCCO)nc(S(C)(=O)=O)n2)cc1C.
What is the InChIKey of 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol?
The InChIKey is UYLBTLGBYRMZBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3S/c1-11-6-7-13(9-12(11)2)15-10-14(5-4-8-19)17-16(18-15)22(3,20)21/h6-7,9-10,19H,4-5,8H2,1-3H3.
What are the key properties of 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol?
3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol has a molecular weight of 320.41 g/mol, XLogP of 2.09, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(3,4-dimethylphenyl)-2-methylsulfonylpyrimidin-4-yl]propan-1-ol is sourced from PubChem (CID 69047064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).