About 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one
4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one (PubChem CID 69047390) has the molecular formula C11H9F3N2O
and a molecular weight of 242.20 g/mol. Its IUPAC name is 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one |
| PubChem CID | 69047390 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one |
| SMILES | O=c1cc(C2=CC=C(C(F)(F)F)CN2)cc[nH]1 |
| InChI | InChI=1S/C11H9F3N2O/c12-11(13,14)8-1-2-9(16-6-8)7-3-4-15-10(17)5-7/h1-5,16H,6H2,(H,15,17) |
| InChIKey | HIWQLIVKENHKOY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one?
The IUPAC name of 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one (CID 69047390) is 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one.
What is the SMILES notation for 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one?
The canonical SMILES for 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one is O=c1cc(C2=CC=C(C(F)(F)F)CN2)cc[nH]1.
What is the InChIKey of 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one?
The InChIKey is HIWQLIVKENHKOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N2O/c12-11(13,14)8-1-2-9(16-6-8)7-3-4-15-10(17)5-7/h1-5,16H,6H2,(H,15,17).
What are the key properties of 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one?
4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one has a molecular weight of 242.20 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(trifluoromethyl)-1,2-dihydropyridin-6-yl]-1H-pyridin-2-one is sourced from PubChem (CID 69047390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).