C7H9NOS — CID 69048553
3a,4,5,6-tetrahydrothieno[3,2-b]pyridin-3-one (PubChem CID 69048553) has the molecular formula C7H9NOS and a molecular weight of 155.22 g/mol. Its IUPAC name is 3a,4,5,6-tetrahydrothieno[3,2-b]pyridin-3-one.
| Compound Name | 3a,4,5,6-tetrahydrothieno[3,2-b]pyridin-3-one |
|---|---|
| PubChem CID | 69048553 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 3a,4,5,6-tetrahydrothieno[3,2-b]pyridin-3-one |
| SMILES | O=C1CSC2=CCCNC12 |
| InChI | InChI=1S/C7H9NOS/c9-5-4-10-6-2-1-3-8-7(5)6/h2,7-8H,1,3-4H2 |
| InChIKey | URRMOUMUAVELBF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |