About (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine
(E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine (PubChem CID 6904880) has the molecular formula C17H17N3O3S
and a molecular weight of 343.41 g/mol. Its IUPAC name is (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine |
| PubChem CID | 6904880 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2cc(OC)ccc2OC)n1/N=C/c1ccco1 |
| InChI | InChI=1S/C17H17N3O3S/c1-18-17-20(19-10-13-5-4-8-23-13)15(11-24-17)14-9-12(21-2)6-7-16(14)22-3/h4-11H,1-3H3/b18-17-,19-10+ |
| InChIKey | VASVYCQELJFUOP-PRUPWKLTSA-N |
| XLogP | 3.24 |
| TPSA | 61.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine?
The IUPAC name of (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine (CID 6904880) is (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine.
What is the SMILES notation for (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine?
The canonical SMILES for (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine is C/N=c1\scc(-c2cc(OC)ccc2OC)n1/N=C/c1ccco1.
What is the InChIKey of (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine?
The InChIKey is VASVYCQELJFUOP-PRUPWKLTSA-N. The full InChI is InChI=1S/C17H17N3O3S/c1-18-17-20(19-10-13-5-4-8-23-13)15(11-24-17)14-9-12(21-2)6-7-16(14)22-3/h4-11H,1-3H3/b18-17-,19-10+.
What are the key properties of (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine?
(E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine has a molecular weight of 343.41 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,5-dimethoxyphenyl)-3-[(E)-furan-2-ylmethylideneamino]-N-methyl-1,3-thiazol-2-imine is sourced from PubChem (CID 6904880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).