About biphenylene;9H-xanthene
biphenylene;9H-xanthene (PubChem CID 69049558) has the molecular formula C25H18O
and a molecular weight of 334.42 g/mol. Its IUPAC name is biphenylene;9H-xanthene.
Molecular Properties
| Compound Name | biphenylene;9H-xanthene |
| PubChem CID | 69049558 |
| Molecular Formula | C25H18O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | biphenylene;9H-xanthene |
| SMILES | c1ccc2c(c1)-c1ccccc1-2.c1ccc2c(c1)Cc1ccccc1O2 |
| InChI | InChI=1S/C13H10O.C12H8/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H,9H2;1-8H |
| InChIKey | HWCBFKYCOOXLOD-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze biphenylene;9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;9H-xanthene?
The IUPAC name of biphenylene;9H-xanthene (CID 69049558) is biphenylene;9H-xanthene.
What is the SMILES notation for biphenylene;9H-xanthene?
The canonical SMILES for biphenylene;9H-xanthene is c1ccc2c(c1)-c1ccccc1-2.c1ccc2c(c1)Cc1ccccc1O2.
What is the InChIKey of biphenylene;9H-xanthene?
The InChIKey is HWCBFKYCOOXLOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C12H8/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H,9H2;1-8H.
What are the key properties of biphenylene;9H-xanthene?
biphenylene;9H-xanthene has a molecular weight of 334.42 g/mol, XLogP of 6.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;9H-xanthene is sourced from PubChem (CID 69049558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).