C26H21ClN2O4 — CID 69050043
4-[[4-[3-chloro-4-[(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]methyl]-3-methyl-1,3-oxazolidin-2-one (PubChem CID 69050043) has the molecular formula C26H21ClN2O4 and a molecular weight of 460.92 g/mol. Its IUPAC name is 4-[[4-[3-chloro-4-[(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]methyl]-3-methyl-1,3-oxazolidin-2-one.
| Compound Name | 4-[[4-[3-chloro-4-[(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]methyl]-3-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69050043 |
| Molecular Formula | C26H21ClN2O4 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-[[4-[3-chloro-4-[(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]methyl]-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1C(=O)OCC1Cc1ccc(Oc2ccc(C=C3C(=O)Nc4ccccc43)c(Cl)c2)cc1 |
| InChI | InChI=1S/C26H21ClN2O4/c1-29-18(15-32-26(29)31)12-16-6-9-19(10-7-16)33-20-11-8-17(23(27)14-20)13-22-21-4-2-3-5-24(21)28-25(22)30/h2-11,13-14,18H,12,15H2,1H3,(H,28,30) |
| InChIKey | ONLKVJKHYPNYEI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|