About 3,7-dioxo-1,4-diazepane-5-carboxylic acid
3,7-dioxo-1,4-diazepane-5-carboxylic acid (PubChem CID 69050317) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is 3,7-dioxo-1,4-diazepane-5-carboxylic acid.
Molecular Properties
| Compound Name | 3,7-dioxo-1,4-diazepane-5-carboxylic acid |
| PubChem CID | 69050317 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 3,7-dioxo-1,4-diazepane-5-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)NC(=O)CN1 |
| InChI | InChI=1S/C6H8N2O4/c9-4-1-3(6(11)12)8-5(10)2-7-4/h3H,1-2H2,(H,7,9)(H,8,10)(H,11,12) |
| InChIKey | RGCDREJCTDPEHP-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,7-dioxo-1,4-diazepane-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dioxo-1,4-diazepane-5-carboxylic acid?
The IUPAC name of 3,7-dioxo-1,4-diazepane-5-carboxylic acid (CID 69050317) is 3,7-dioxo-1,4-diazepane-5-carboxylic acid.
What is the SMILES notation for 3,7-dioxo-1,4-diazepane-5-carboxylic acid?
The canonical SMILES for 3,7-dioxo-1,4-diazepane-5-carboxylic acid is O=C1CC(C(=O)O)NC(=O)CN1.
What is the InChIKey of 3,7-dioxo-1,4-diazepane-5-carboxylic acid?
The InChIKey is RGCDREJCTDPEHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4/c9-4-1-3(6(11)12)8-5(10)2-7-4/h3H,1-2H2,(H,7,9)(H,8,10)(H,11,12).
What are the key properties of 3,7-dioxo-1,4-diazepane-5-carboxylic acid?
3,7-dioxo-1,4-diazepane-5-carboxylic acid has a molecular weight of 172.14 g/mol, XLogP of -1.92, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dioxo-1,4-diazepane-5-carboxylic acid is sourced from PubChem (CID 69050317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).