About 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione
3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 6905035) has the molecular formula C18H19N5S
and a molecular weight of 337.45 g/mol. Its IUPAC name is 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| PubChem CID | 6905035 |
| Molecular Formula | C18H19N5S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1/N=C/c1ccc(N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N5S/c1-3-17-20-21-18(24)23(17)19-13-14-9-11-16(12-10-14)22(2)15-7-5-4-6-8-15/h4-13H,3H2,1-2H3,(H,21,24)/b19-13+ |
| InChIKey | ATSAFZZESPWYCT-CPNJWEJPSA-N |
| XLogP | 4.15 |
| TPSA | 49.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione?
The IUPAC name of 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (CID 6905035) is 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
What is the SMILES notation for 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione?
The canonical SMILES for 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione is CCc1n[nH]c(=S)n1/N=C/c1ccc(N(C)c2ccccc2)cc1.
What is the InChIKey of 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione?
The InChIKey is ATSAFZZESPWYCT-CPNJWEJPSA-N. The full InChI is InChI=1S/C18H19N5S/c1-3-17-20-21-18(24)23(17)19-13-14-9-11-16(12-10-14)22(2)15-7-5-4-6-8-15/h4-13H,3H2,1-2H3,(H,21,24)/b19-13+.
What are the key properties of 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione?
3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione has a molecular weight of 337.45 g/mol, XLogP of 4.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-[(E)-[4-(N-methylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione is sourced from PubChem (CID 6905035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).