2,2-dimethyl-4-(3-methylphenyl)butanoic acid

C13H18O2 — CID 69050886

IUPAC2,2-dimethyl-4-(3-methylphenyl)butanoic acid
SMILESCc1cccc(CCC(C)(C)C(=O)O)c1
InChIInChI=1S/C13H18O2/c1-10-5-4-6-11(9-10)7-8-13(2,3)12(14)15/h4-6,9H,7-8H2,1-3H3,(H,14,15)
InChIKeyBCIRWXZFVUTURS-UHFFFAOYSA-N
MW206.28 g/mol
LogP3.04
Rot. Bonds4

About 2,2-dimethyl-4-(3-methylphenyl)butanoic acid

2,2-dimethyl-4-(3-methylphenyl)butanoic acid (PubChem CID 69050886) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 2,2-dimethyl-4-(3-methylphenyl)butanoic acid.

Molecular Properties

Compound Name2,2-dimethyl-4-(3-methylphenyl)butanoic acid
PubChem CID69050886
Molecular FormulaC13H18O2
Molecular Weight206.28 g/mol
Exact Mass206.13
IUPAC Name2,2-dimethyl-4-(3-methylphenyl)butanoic acid
SMILESCc1cccc(CCC(C)(C)C(=O)O)c1
InChIInChI=1S/C13H18O2/c1-10-5-4-6-11(9-10)7-8-13(2,3)12(14)15/h4-6,9H,7-8H2,1-3H3,(H,14,15)
InChIKeyBCIRWXZFVUTURS-UHFFFAOYSA-N
XLogP3.04
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.28
LogP ≤ 53.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,2-dimethyl-4-(3-methylphenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-4-(3-methylphenyl)butanoic acid?
The IUPAC name of 2,2-dimethyl-4-(3-methylphenyl)butanoic acid (CID 69050886) is 2,2-dimethyl-4-(3-methylphenyl)butanoic acid.
What is the SMILES notation for 2,2-dimethyl-4-(3-methylphenyl)butanoic acid?
The canonical SMILES for 2,2-dimethyl-4-(3-methylphenyl)butanoic acid is Cc1cccc(CCC(C)(C)C(=O)O)c1.
What is the InChIKey of 2,2-dimethyl-4-(3-methylphenyl)butanoic acid?
The InChIKey is BCIRWXZFVUTURS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-10-5-4-6-11(9-10)7-8-13(2,3)12(14)15/h4-6,9H,7-8H2,1-3H3,(H,14,15).
What are the key properties of 2,2-dimethyl-4-(3-methylphenyl)butanoic acid?
2,2-dimethyl-4-(3-methylphenyl)butanoic acid has a molecular weight of 206.28 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-(3-methylphenyl)butanoic acid is sourced from PubChem (CID 69050886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).