C10H13N3O6 — CID 69050981
2-amino-3-(1H-imidazol-5-yl)propanoic acid;(Z)-but-2-enedioic acid (PubChem CID 69050981) has the molecular formula C10H13N3O6 and a molecular weight of 271.23 g/mol. Its IUPAC name is 2-amino-3-(1H-imidazol-5-yl)propanoic acid;(Z)-but-2-enedioic acid.
| Compound Name | 2-amino-3-(1H-imidazol-5-yl)propanoic acid;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 69050981 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-amino-3-(1H-imidazol-5-yl)propanoic acid;(Z)-but-2-enedioic acid |
| SMILES | NC(Cc1cnc[nH]1)C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C6H9N3O2.C4H4O4/c7-5(6(10)11)1-4-2-8-3-9-4;5-3(6)1-2-4(7)8/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | QWSZFCZVEWWKGC-BTJKTKAUSA-N |
| XLogP | -0.92 |
| TPSA | 166.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|