About tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate
tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 69051191) has the molecular formula C28H41N3O2
and a molecular weight of 451.66 g/mol. Its IUPAC name is tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate |
| PubChem CID | 69051191 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)n2)CC1 |
| InChI | InChI=1S/C28H41N3O2/c1-26(2,3)21-17-20(18-22(19-21)27(4,5)6)23-11-10-12-24(29-23)30-13-15-31(16-14-30)25(32)33-28(7,8)9/h10-12,17-19H,13-16H2,1-9H3 |
| InChIKey | FILWQMYPWGBMBS-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate (CID 69051191) is tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(c2cccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)n2)CC1.
What is the InChIKey of tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate?
The InChIKey is FILWQMYPWGBMBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H41N3O2/c1-26(2,3)21-17-20(18-22(19-21)27(4,5)6)23-11-10-12-24(29-23)30-13-15-31(16-14-30)25(32)33-28(7,8)9/h10-12,17-19H,13-16H2,1-9H3.
What are the key properties of tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate?
tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate has a molecular weight of 451.66 g/mol, XLogP of 6.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[6-(3,5-ditert-butylphenyl)-2-pyridinyl]piperazine-1-carboxylate is sourced from PubChem (CID 69051191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).