C5H5NO2S — CID 69051281
methyl 1,2-thiazole-4-carboxylate (PubChem CID 69051281) has the molecular formula C5H5NO2S and a molecular weight of 143.17 g/mol. Its IUPAC name is methyl 1,2-thiazole-4-carboxylate.
| Compound Name | methyl 1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 69051281 |
| Molecular Formula | C5H5NO2S |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.00 |
| IUPAC Name | methyl 1,2-thiazole-4-carboxylate |
| SMILES | COC(=O)c1cnsc1 |
| InChI | InChI=1S/C5H5NO2S/c1-8-5(7)4-2-6-9-3-4/h2-3H,1H3 |
| InChIKey | YELIYGBMHIGZIN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |