About 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride
1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride (PubChem CID 69051523) has the molecular formula C20H25Cl2N3O4S
and a molecular weight of 474.41 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride |
| PubChem CID | 69051523 |
| Molecular Formula | C20H25Cl2N3O4S |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride |
| SMILES | COc1ccc(S(=O)(=O)n2ccc3cc(N4CCNCC4)ccc32)cc1OC.Cl.Cl |
| InChI | InChI=1S/C20H23N3O4S.2ClH/c1-26-19-6-4-17(14-20(19)27-2)28(24,25)23-10-7-15-13-16(3-5-18(15)23)22-11-8-21-9-12-22;;/h3-7,10,13-14,21H,8-9,11-12H2,1-2H3;2*1H |
| InChIKey | LLWWKDKJDOSYSQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride?
The IUPAC name of 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride (CID 69051523) is 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride is COc1ccc(S(=O)(=O)n2ccc3cc(N4CCNCC4)ccc32)cc1OC.Cl.Cl.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride?
The InChIKey is LLWWKDKJDOSYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O4S.2ClH/c1-26-19-6-4-17(14-20(19)27-2)28(24,25)23-10-7-15-13-16(3-5-18(15)23)22-11-8-21-9-12-22;;/h3-7,10,13-14,21H,8-9,11-12H2,1-2H3;2*1H.
What are the key properties of 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride?
1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride has a molecular weight of 474.41 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)sulfonyl-5-piperazin-1-ylindole;dihydrochloride is sourced from PubChem (CID 69051523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).