About (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate
(1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate (PubChem CID 69051608) has the molecular formula C20H30O5
and a molecular weight of 350.46 g/mol. Its IUPAC name is (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate.
Molecular Properties
| Compound Name | (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate |
| PubChem CID | 69051608 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate |
| SMILES | CCC1=C(C(C)(C)C)C(=O)C(C(C)(C)C)=CC1(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C20H30O5/c1-10-14-16(19(7,8)9)17(23)15(18(4,5)6)11-20(14,24-12(2)21)25-13(3)22/h11H,10H2,1-9H3 |
| InChIKey | KBDUNSAZODARDW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate?
The IUPAC name of (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate (CID 69051608) is (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate.
What is the SMILES notation for (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate?
The canonical SMILES for (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate is CCC1=C(C(C)(C)C)C(=O)C(C(C)(C)C)=CC1(OC(C)=O)OC(C)=O.
What is the InChIKey of (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate?
The InChIKey is KBDUNSAZODARDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O5/c1-10-14-16(19(7,8)9)17(23)15(18(4,5)6)11-20(14,24-12(2)21)25-13(3)22/h11H,10H2,1-9H3.
What are the key properties of (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate?
(1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate has a molecular weight of 350.46 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetyloxy-3,5-ditert-butyl-2-ethyl-4-oxocyclohexa-2,5-dien-1-yl) acetate is sourced from PubChem (CID 69051608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).