About 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride
2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride (PubChem CID 69051761) has the molecular formula C5H11Cl2N5S
and a molecular weight of 244.15 g/mol. Its IUPAC name is 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride |
| PubChem CID | 69051761 |
| Molecular Formula | C5H11Cl2N5S |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride |
| SMILES | CSc1nc(N)c(N)c(N)n1.Cl.Cl |
| InChI | InChI=1S/C5H9N5S.2ClH/c1-11-5-9-3(7)2(6)4(8)10-5;;/h6H2,1H3,(H4,7,8,9,10);2*1H |
| InChIKey | YKATYPRZCXDBBM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride?
The IUPAC name of 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride (CID 69051761) is 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride.
What is the SMILES notation for 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride?
The canonical SMILES for 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride is CSc1nc(N)c(N)c(N)n1.Cl.Cl.
What is the InChIKey of 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride?
The InChIKey is YKATYPRZCXDBBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5S.2ClH/c1-11-5-9-3(7)2(6)4(8)10-5;;/h6H2,1H3,(H4,7,8,9,10);2*1H.
What are the key properties of 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride?
2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride has a molecular weight of 244.15 g/mol, XLogP of 0.79, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylpyrimidine-4,5,6-triamine;dihydrochloride is sourced from PubChem (CID 69051761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).