About methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate
methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 69051812) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 69051812 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1C=CC(OC)=CC1(OC)C(C)C |
| InChI | InChI=1S/C13H20O4/c1-9(2)13(17-5)8-10(15-3)6-7-11(13)12(14)16-4/h6-9,11H,1-5H3 |
| InChIKey | HCYPOGBZPNIRQQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate (CID 69051812) is methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate is COC(=O)C1C=CC(OC)=CC1(OC)C(C)C.
What is the InChIKey of methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is HCYPOGBZPNIRQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O4/c1-9(2)13(17-5)8-10(15-3)6-7-11(13)12(14)16-4/h6-9,11H,1-5H3.
What are the key properties of methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate?
methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 240.30 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,6-dimethoxy-6-propan-2-ylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 69051812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).