C16H16F4O2 — CID 69052219
[fluoro-(2,3,4-trifluorophenyl)methyl] 2,2-dimethyl-3-prop-1-enylcyclopropane-1-carboxylate (PubChem CID 69052219) has the molecular formula C16H16F4O2 and a molecular weight of 316.29 g/mol. Its IUPAC name is [fluoro-(2,3,4-trifluorophenyl)methyl] 2,2-dimethyl-3-prop-1-enylcyclopropane-1-carboxylate.
| Compound Name | [fluoro-(2,3,4-trifluorophenyl)methyl] 2,2-dimethyl-3-prop-1-enylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 69052219 |
| Molecular Formula | C16H16F4O2 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [fluoro-(2,3,4-trifluorophenyl)methyl] 2,2-dimethyl-3-prop-1-enylcyclopropane-1-carboxylate |
| SMILES | CC=CC1C(C(=O)OC(F)c2ccc(F)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C16H16F4O2/c1-4-5-9-11(16(9,2)3)15(21)22-14(20)8-6-7-10(17)13(19)12(8)18/h4-7,9,11,14H,1-3H3 |
| InChIKey | ZLNRWQCSJCASTH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|