C11H9F2N3O2 — CID 6905317
2-cyano-N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]acetamide (PubChem CID 6905317) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is 2-cyano-N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-cyano-N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6905317 |
| Molecular Formula | C11H9F2N3O2 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-cyano-N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]acetamide |
| SMILES | N#CCC(=O)N/N=C/c1ccccc1OC(F)F |
| InChI | InChI=1S/C11H9F2N3O2/c12-11(13)18-9-4-2-1-3-8(9)7-15-16-10(17)5-6-14/h1-4,7,11H,5H2,(H,16,17)/b15-7+ |
| InChIKey | KHXXROZIDFQJEI-VIZOYTHASA-N |
| XLogP | 1.65 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|