About tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate
tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 69053296) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 69053296 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2ncc[nH]2)CC1 |
| InChI | InChI=1S/C13H19N3O2/c1-13(2,3)18-12(17)16-8-4-10(5-9-16)11-14-6-7-15-11/h4,6-7H,5,8-9H2,1-3H3,(H,14,15) |
| InChIKey | VXESIQITZBRNNA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (CID 69053296) is tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate is CC(C)(C)OC(=O)N1CC=C(c2ncc[nH]2)CC1.
What is the InChIKey of tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is VXESIQITZBRNNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-13(2,3)18-12(17)16-8-4-10(5-9-16)11-14-6-7-15-11/h4,6-7H,5,8-9H2,1-3H3,(H,14,15).
What are the key properties of tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate?
tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 249.31 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(1H-imidazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 69053296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).