About 7aH-indole-2-carboxamide
7aH-indole-2-carboxamide (PubChem CID 69053470) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 7aH-indole-2-carboxamide.
Molecular Properties
| Compound Name | 7aH-indole-2-carboxamide |
| PubChem CID | 69053470 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 7aH-indole-2-carboxamide |
| SMILES | NC(=O)C1=NC2C=CC=CC2=C1 |
| InChI | InChI=1S/C9H8N2O/c10-9(12)8-5-6-3-1-2-4-7(6)11-8/h1-5,7H,(H2,10,12) |
| InChIKey | XZRYTCBMOQQPDU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7aH-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7aH-indole-2-carboxamide?
The IUPAC name of 7aH-indole-2-carboxamide (CID 69053470) is 7aH-indole-2-carboxamide.
What is the SMILES notation for 7aH-indole-2-carboxamide?
The canonical SMILES for 7aH-indole-2-carboxamide is NC(=O)C1=NC2C=CC=CC2=C1.
What is the InChIKey of 7aH-indole-2-carboxamide?
The InChIKey is XZRYTCBMOQQPDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c10-9(12)8-5-6-3-1-2-4-7(6)11-8/h1-5,7H,(H2,10,12).
What are the key properties of 7aH-indole-2-carboxamide?
7aH-indole-2-carboxamide has a molecular weight of 160.18 g/mol, XLogP of 0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7aH-indole-2-carboxamide is sourced from PubChem (CID 69053470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).