About 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine
2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine (PubChem CID 69053668) has the molecular formula C11H24N6
and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine.
Molecular Properties
| Compound Name | 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine |
| PubChem CID | 69053668 |
| Molecular Formula | C11H24N6 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine |
| SMILES | CCN(CC)CCCC1(N)N=C(N)C=C(N)N1 |
| InChI | InChI=1S/C11H24N6/c1-3-17(4-2)7-5-6-11(14)15-9(12)8-10(13)16-11/h8,15H,3-7,12,14H2,1-2H3,(H2,13,16) |
| InChIKey | UKMAFXTVCVIARD-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine?
The IUPAC name of 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine (CID 69053668) is 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine.
What is the SMILES notation for 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine?
The canonical SMILES for 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine is CCN(CC)CCCC1(N)N=C(N)C=C(N)N1.
What is the InChIKey of 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine?
The InChIKey is UKMAFXTVCVIARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N6/c1-3-17(4-2)7-5-6-11(14)15-9(12)8-10(13)16-11/h8,15H,3-7,12,14H2,1-2H3,(H2,13,16).
What are the key properties of 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine?
2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine has a molecular weight of 240.35 g/mol, XLogP of -0.52, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(diethylamino)propyl]-1H-pyrimidine-2,4,6-triamine is sourced from PubChem (CID 69053668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).