About cyclopentene;1-ethenylsulfonylethene
cyclopentene;1-ethenylsulfonylethene (PubChem CID 69053806) has the molecular formula C9H14O2S
and a molecular weight of 186.28 g/mol. Its IUPAC name is cyclopentene;1-ethenylsulfonylethene.
Molecular Properties
| Compound Name | cyclopentene;1-ethenylsulfonylethene |
| PubChem CID | 69053806 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | cyclopentene;1-ethenylsulfonylethene |
| SMILES | C1=CCCC1.C=CS(=O)(=O)C=C |
| InChI | InChI=1S/C5H8.C4H6O2S/c1-2-4-5-3-1;1-3-7(5,6)4-2/h1-2H,3-5H2;3-4H,1-2H2 |
| InChIKey | KMIVNQFKMYOHAC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopentene;1-ethenylsulfonylethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentene;1-ethenylsulfonylethene?
The IUPAC name of cyclopentene;1-ethenylsulfonylethene (CID 69053806) is cyclopentene;1-ethenylsulfonylethene.
What is the SMILES notation for cyclopentene;1-ethenylsulfonylethene?
The canonical SMILES for cyclopentene;1-ethenylsulfonylethene is C1=CCCC1.C=CS(=O)(=O)C=C.
What is the InChIKey of cyclopentene;1-ethenylsulfonylethene?
The InChIKey is KMIVNQFKMYOHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8.C4H6O2S/c1-2-4-5-3-1;1-3-7(5,6)4-2/h1-2H,3-5H2;3-4H,1-2H2.
What are the key properties of cyclopentene;1-ethenylsulfonylethene?
cyclopentene;1-ethenylsulfonylethene has a molecular weight of 186.28 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentene;1-ethenylsulfonylethene is sourced from PubChem (CID 69053806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).