C20H30O4 — CID 69053929
[(3aS,4R,6aR,7R,10S,10aS)-2,2,5,10-tetramethyl-7-prop-1-en-2-yl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl] acetate (PubChem CID 69053929) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is [(3aS,4R,6aR,7R,10S,10aS)-2,2,5,10-tetramethyl-7-prop-1-en-2-yl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl] acetate.
| Compound Name | [(3aS,4R,6aR,7R,10S,10aS)-2,2,5,10-tetramethyl-7-prop-1-en-2-yl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 69053929 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [(3aS,4R,6aR,7R,10S,10aS)-2,2,5,10-tetramethyl-7-prop-1-en-2-yl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl] acetate |
| SMILES | C=C(C)[C@@H]1CC[C@H](C)[C@@]23OC(C)(C)O[C@H]2[C@H](OC(C)=O)C(C)=C[C@H]13 |
| InChI | InChI=1S/C20H30O4/c1-11(2)15-9-8-13(4)20-16(15)10-12(3)17(22-14(5)21)18(20)23-19(6,7)24-20/h10,13,15-18H,1,8-9H2,2-7H3/t13-,15-,16+,17+,18-,20-/m0/s1 |
| InChIKey | CNXVTGLBRFBJKP-GFTCLSJWSA-N |
| XLogP | 4.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|