About 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine
3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 69054615) has the molecular formula C10H13N5S
and a molecular weight of 235.32 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| PubChem CID | 69054615 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | Cc1csc(=NN=Cc2nccn2C)n1C |
| InChI | InChI=1S/C10H13N5S/c1-8-7-16-10(15(8)3)13-12-6-9-11-4-5-14(9)2/h4-7H,1-3H3 |
| InChIKey | WNMNRZDWZHEIQZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 47.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine?
The IUPAC name of 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine (CID 69054615) is 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine.
What is the SMILES notation for 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine?
The canonical SMILES for 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine is Cc1csc(=NN=Cc2nccn2C)n1C.
What is the InChIKey of 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine?
The InChIKey is WNMNRZDWZHEIQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5S/c1-8-7-16-10(15(8)3)13-12-6-9-11-4-5-14(9)2/h4-7H,1-3H3.
What are the key properties of 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine?
3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine has a molecular weight of 235.32 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-N-[(1-methylimidazol-2-yl)methylideneamino]-1,3-thiazol-2-imine is sourced from PubChem (CID 69054615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).