C33H48O8 — CID 69054747
6,6'-bis[1-(2-ethoxyethoxy)ethoxy]-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol (PubChem CID 69054747) has the molecular formula C33H48O8 and a molecular weight of 572.74 g/mol. Its IUPAC name is 6,6'-bis[1-(2-ethoxyethoxy)ethoxy]-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol.
| Compound Name | 6,6'-bis[1-(2-ethoxyethoxy)ethoxy]-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol |
|---|---|
| PubChem CID | 69054747 |
| Molecular Formula | C33H48O8 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 6,6'-bis[1-(2-ethoxyethoxy)ethoxy]-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol |
| SMILES | CCOCCOC(C)Oc1cc2c(cc1O)C1(CC2(C)C)CC(C)(C)c2cc(OC(C)OCCOCC)c(O)cc21 |
| InChI | InChI=1S/C33H48O8/c1-9-36-11-13-38-21(3)40-29-17-23-25(15-27(29)34)33(19-31(23,5)6)20-32(7,8)24-18-30(28(35)16-26(24)33)41-22(4)39-14-12-37-10-2/h15-18,21-22,34-35H,9-14,19-20H2,1-8H3 |
| InChIKey | YBXANRWABNZUAY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|