About CID 69055429
CID 69055429 (PubChem CID 69055429) has the molecular formula C12H6BCl2F2O2
and a molecular weight of 301.89 g/mol.
Molecular Properties
| Compound Name | CID 69055429 |
| PubChem CID | 69055429 |
| Molecular Formula | C12H6BCl2F2O2 |
| Molecular Weight | 301.89 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | — |
| SMILES | Fc1ccc(Cl)c(O[B]Oc2cc(F)ccc2Cl)c1 |
| InChI | InChI=1S/C12H6BCl2F2O2/c14-9-3-1-7(16)5-11(9)18-13-19-12-6-8(17)2-4-10(12)15/h1-6H |
| InChIKey | HMIKPZJDSAGRHQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 69055429 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69055429?
The IUPAC name of CID 69055429 (CID 69055429) is not available.
What is the SMILES notation for CID 69055429?
The canonical SMILES for CID 69055429 is Fc1ccc(Cl)c(O[B]Oc2cc(F)ccc2Cl)c1.
What is the InChIKey of CID 69055429?
The InChIKey is HMIKPZJDSAGRHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BCl2F2O2/c14-9-3-1-7(16)5-11(9)18-13-19-12-6-8(17)2-4-10(12)15/h1-6H.
What are the key properties of CID 69055429?
CID 69055429 has a molecular weight of 301.89 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69055429 is sourced from PubChem (CID 69055429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).