C26H19F2N3O2 — CID 69055515
(E)-3-[1-[bis(4-fluorophenyl)methyl]-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid (PubChem CID 69055515) has the molecular formula C26H19F2N3O2 and a molecular weight of 443.45 g/mol. Its IUPAC name is (E)-3-[1-[bis(4-fluorophenyl)methyl]-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[bis(4-fluorophenyl)methyl]-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69055515 |
| Molecular Formula | C26H19F2N3O2 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (E)-3-[1-[bis(4-fluorophenyl)methyl]-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid |
| SMILES | Cc1cc(C)c2c(C#N)c(/C=C/C(=O)O)n(C(c3ccc(F)cc3)c3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C26H19F2N3O2/c1-15-13-16(2)30-26-24(15)21(14-29)22(11-12-23(32)33)31(26)25(17-3-7-19(27)8-4-17)18-5-9-20(28)10-6-18/h3-13,25H,1-2H3,(H,32,33)/b12-11+ |
| InChIKey | UYXAEUWQNXGEJK-VAWYXSNFSA-N |
| XLogP | 5.54 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|