C21H26N2O3 — CID 69055536
4-[(dibenzylamino)methyl]-3-hydroxypiperidine-1-carboxylic acid (PubChem CID 69055536) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[(dibenzylamino)methyl]-3-hydroxypiperidine-1-carboxylic acid.
| Compound Name | 4-[(dibenzylamino)methyl]-3-hydroxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69055536 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 4-[(dibenzylamino)methyl]-3-hydroxypiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(CN(Cc2ccccc2)Cc2ccccc2)C(O)C1 |
| InChI | InChI=1S/C21H26N2O3/c24-20-16-23(21(25)26)12-11-19(20)15-22(13-17-7-3-1-4-8-17)14-18-9-5-2-6-10-18/h1-10,19-20,24H,11-16H2,(H,25,26) |
| InChIKey | ZMEPDFGRISPIIU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |