C24H33NO6 — CID 69055633
2-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenoxy]ethyl-methylcarbamic acid (PubChem CID 69055633) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenoxy]ethyl-methylcarbamic acid.
| Compound Name | 2-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenoxy]ethyl-methylcarbamic acid |
|---|---|
| PubChem CID | 69055633 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 2-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenoxy]ethyl-methylcarbamic acid |
| SMILES | CCc1cc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)ccc1OCCN(C)C(=O)O |
| InChI | InChI=1S/C24H33NO6/c1-3-18-14-17(8-9-21(18)30-13-12-25(2)23(28)29)10-11-24(19-6-4-5-7-19)16-20(26)15-22(27)31-24/h8-9,14,19H,3-7,10-13,15-16H2,1-2H3,(H,28,29) |
| InChIKey | GKGWDRUJYOHQSY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|