About methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate
methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate (PubChem CID 6905599) has the molecular formula C16H13Cl2NO3
and a molecular weight of 338.19 g/mol. Its IUPAC name is methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate |
| PubChem CID | 6905599 |
| Molecular Formula | C16H13Cl2NO3 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(CO/N=C/c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H13Cl2NO3/c1-21-16(20)12-4-2-11(3-5-12)10-22-19-9-13-6-7-14(17)8-15(13)18/h2-9H,10H2,1H3/b19-9+ |
| InChIKey | FOIBNRDSDGSYEH-DJKKODMXSA-N |
| XLogP | 4.33 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate?
The IUPAC name of methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate (CID 6905599) is methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate.
What is the SMILES notation for methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate?
The canonical SMILES for methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate is COC(=O)c1ccc(CO/N=C/c2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate?
The InChIKey is FOIBNRDSDGSYEH-DJKKODMXSA-N. The full InChI is InChI=1S/C16H13Cl2NO3/c1-21-16(20)12-4-2-11(3-5-12)10-22-19-9-13-6-7-14(17)8-15(13)18/h2-9H,10H2,1H3/b19-9+.
What are the key properties of methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate?
methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate has a molecular weight of 338.19 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(E)-(2,4-dichlorophenyl)methylideneamino]oxymethyl]benzoate is sourced from PubChem (CID 6905599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).