C16H15FN2O3 — CID 69056051
2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3,5-dimethyl-1,2-dihydropyrrole-3-carboxylic acid (PubChem CID 69056051) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3,5-dimethyl-1,2-dihydropyrrole-3-carboxylic acid.
| Compound Name | 2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3,5-dimethyl-1,2-dihydropyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 69056051 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3,5-dimethyl-1,2-dihydropyrrole-3-carboxylic acid |
| SMILES | CC1=CC(C)(C(=O)O)C(C=C2C(=O)Nc3ccc(F)cc32)N1 |
| InChI | InChI=1S/C16H15FN2O3/c1-8-7-16(2,15(21)22)13(18-8)6-11-10-5-9(17)3-4-12(10)19-14(11)20/h3-7,13,18H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | UAOCFVOSRHCASX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|