C15H25NO2 — CID 69056441
tert-butyl 4-pentylidene-2,3-dihydropyridine-1-carboxylate (PubChem CID 69056441) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is tert-butyl 4-pentylidene-2,3-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl 4-pentylidene-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 69056441 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | tert-butyl 4-pentylidene-2,3-dihydropyridine-1-carboxylate |
| SMILES | CCCCC=C1C=CN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H25NO2/c1-5-6-7-8-13-9-11-16(12-10-13)14(17)18-15(2,3)4/h8-9,11H,5-7,10,12H2,1-4H3 |
| InChIKey | AUSZCQXXPPFHLW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|