C21H28N2O3 — CID 69057039
methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,8,9,11,12,14,15,16,17,18,19,20,21-tetradecahydroyohimban-19-carboxylate (PubChem CID 69057039) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,8,9,11,12,14,15,16,17,18,19,20,21-tetradecahydroyohimban-19-carboxylate.
| Compound Name | methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,8,9,11,12,14,15,16,17,18,19,20,21-tetradecahydroyohimban-19-carboxylate |
|---|---|
| PubChem CID | 69057039 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,8,9,11,12,14,15,16,17,18,19,20,21-tetradecahydroyohimban-19-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@H]3C4=C(CCN3C[C@@H]2CC[C@@H]1O)C1CC=CC=C1N4 |
| InChI | InChI=1S/C21H28N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-3,5,12-13,15,17-19,22,24H,4,6-11H2,1H3/t12-,13?,15-,17-,18-,19+/m0/s1 |
| InChIKey | GRLMVJZYOCWVDR-UEOWDSMUSA-N |
| XLogP | 1.96 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |