C26H34F3N7O4 — CID 69057143
(2S)-1-[4-[[methyl-[2-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide (PubChem CID 69057143) has the molecular formula C26H34F3N7O4 and a molecular weight of 565.60 g/mol. Its IUPAC name is (2S)-1-[4-[[methyl-[2-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[4-[[methyl-[2-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69057143 |
| Molecular Formula | C26H34F3N7O4 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | (2S)-1-[4-[[methyl-[2-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]-5-nitropyrimidin-4-yl]amino]methyl]cyclohexyl]pyrrolidine-2-carboxamide |
| SMILES | CN(Cc1ccccc1OC(F)(F)F)c1ncc([N+](=O)[O-])c(N(C)CC2CCC(N3CCC[C@H]3C(N)=O)CC2)n1 |
| InChI | InChI=1S/C26H34F3N7O4/c1-33(15-17-9-11-19(12-10-17)35-13-5-7-20(35)23(30)37)24-21(36(38)39)14-31-25(32-24)34(2)16-18-6-3-4-8-22(18)40-26(27,28)29/h3-4,6,8,14,17,19-20H,5,7,9-13,15-16H2,1-2H3,(H2,30,37)/t17?,19?,20-/m0/s1 |
| InChIKey | LJAMGACEKLWCRZ-UUKMXZOPSA-N |
| XLogP | 3.86 |
| TPSA | 130.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|