C26H20FN3O2 — CID 69057600
3-[3-cyano-1-[(4-fluorophenyl)-phenylmethyl]-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid (PubChem CID 69057600) has the molecular formula C26H20FN3O2 and a molecular weight of 425.46 g/mol. Its IUPAC name is 3-[3-cyano-1-[(4-fluorophenyl)-phenylmethyl]-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid.
| Compound Name | 3-[3-cyano-1-[(4-fluorophenyl)-phenylmethyl]-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69057600 |
| Molecular Formula | C26H20FN3O2 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[3-cyano-1-[(4-fluorophenyl)-phenylmethyl]-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid |
| SMILES | Cc1cc(C)c2c(C#N)c(C=CC(=O)O)n(C(c3ccccc3)c3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C26H20FN3O2/c1-16-14-17(2)29-26-24(16)21(15-28)22(12-13-23(31)32)30(26)25(18-6-4-3-5-7-18)19-8-10-20(27)11-9-19/h3-14,25H,1-2H3,(H,31,32) |
| InChIKey | CYSLHARSQRIEMQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|