About 2,4-dihydrothieno[3,2-c]pyridine
2,4-dihydrothieno[3,2-c]pyridine (PubChem CID 69057626) has the molecular formula C7H7NS
and a molecular weight of 137.21 g/mol. Its IUPAC name is 2,4-dihydrothieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 2,4-dihydrothieno[3,2-c]pyridine |
| PubChem CID | 69057626 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 2,4-dihydrothieno[3,2-c]pyridine |
| SMILES | C1=NCC2=CCSC2=C1 |
| InChI | InChI=1S/C7H7NS/c1-3-8-5-6-2-4-9-7(1)6/h1-3H,4-5H2 |
| InChIKey | OTGQDISDWYDHGN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dihydrothieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydrothieno[3,2-c]pyridine?
The IUPAC name of 2,4-dihydrothieno[3,2-c]pyridine (CID 69057626) is 2,4-dihydrothieno[3,2-c]pyridine.
What is the SMILES notation for 2,4-dihydrothieno[3,2-c]pyridine?
The canonical SMILES for 2,4-dihydrothieno[3,2-c]pyridine is C1=NCC2=CCSC2=C1.
What is the InChIKey of 2,4-dihydrothieno[3,2-c]pyridine?
The InChIKey is OTGQDISDWYDHGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS/c1-3-8-5-6-2-4-9-7(1)6/h1-3H,4-5H2.
What are the key properties of 2,4-dihydrothieno[3,2-c]pyridine?
2,4-dihydrothieno[3,2-c]pyridine has a molecular weight of 137.21 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydrothieno[3,2-c]pyridine is sourced from PubChem (CID 69057626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).