C29H25FN4O — CID 69057972
3-[3-cyano-4,6-dimethyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolo[2,3-b]pyridin-2-yl]-N-(4-fluorophenyl)prop-2-enamide (PubChem CID 69057972) has the molecular formula C29H25FN4O and a molecular weight of 464.54 g/mol. Its IUPAC name is 3-[3-cyano-4,6-dimethyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolo[2,3-b]pyridin-2-yl]-N-(4-fluorophenyl)prop-2-enamide.
| Compound Name | 3-[3-cyano-4,6-dimethyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolo[2,3-b]pyridin-2-yl]-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 69057972 |
| Molecular Formula | C29H25FN4O |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 3-[3-cyano-4,6-dimethyl-1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolo[2,3-b]pyridin-2-yl]-N-(4-fluorophenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c2c(C#N)c(C=CC(=O)Nc3ccc(F)cc3)n([C@H]3CCCc4ccccc43)c2n1 |
| InChI | InChI=1S/C29H25FN4O/c1-18-16-19(2)32-29-28(18)24(17-31)26(14-15-27(35)33-22-12-10-21(30)11-13-22)34(29)25-9-5-7-20-6-3-4-8-23(20)25/h3-4,6,8,10-16,25H,5,7,9H2,1-2H3,(H,33,35)/t25-/m0/s1 |
| InChIKey | CXLOUYLCNGWDBX-VWLOTQADSA-N |
| XLogP | 6.24 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|