C17H24F2O4 — CID 69058271
[(1S,2R,4aS,5R,8S,8aS)-5-(1,1-difluoroprop-1-en-2-yl)-1,8a-dihydroxy-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate (PubChem CID 69058271) has the molecular formula C17H24F2O4 and a molecular weight of 330.37 g/mol. Its IUPAC name is [(1S,2R,4aS,5R,8S,8aS)-5-(1,1-difluoroprop-1-en-2-yl)-1,8a-dihydroxy-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(1S,2R,4aS,5R,8S,8aS)-5-(1,1-difluoroprop-1-en-2-yl)-1,8a-dihydroxy-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 69058271 |
| Molecular Formula | C17H24F2O4 |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [(1S,2R,4aS,5R,8S,8aS)-5-(1,1-difluoroprop-1-en-2-yl)-1,8a-dihydroxy-3,8-dimethyl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(C)=C[C@H]2[C@H](C(C)=C(F)F)CC[C@H](C)[C@@]2(O)[C@H]1O |
| InChI | InChI=1S/C17H24F2O4/c1-8-7-13-12(10(3)16(18)19)6-5-9(2)17(13,22)15(21)14(8)23-11(4)20/h7,9,12-15,21-22H,5-6H2,1-4H3/t9-,12-,13-,14+,15-,17-/m0/s1 |
| InChIKey | FUQUGQYUCBQWOD-UMKYSNGMSA-N |
| XLogP | 2.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|