C20H16N4OS — CID 69058453
4-(4-amino-6-methylthieno[2,3-d]pyrimidin-5-yl)-N-phenylbenzamide (PubChem CID 69058453) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-(4-amino-6-methylthieno[2,3-d]pyrimidin-5-yl)-N-phenylbenzamide.
| Compound Name | 4-(4-amino-6-methylthieno[2,3-d]pyrimidin-5-yl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 69058453 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 4-(4-amino-6-methylthieno[2,3-d]pyrimidin-5-yl)-N-phenylbenzamide |
| SMILES | Cc1sc2ncnc(N)c2c1-c1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N4OS/c1-12-16(17-18(21)22-11-23-20(17)26-12)13-7-9-14(10-8-13)19(25)24-15-5-3-2-4-6-15/h2-11H,1H3,(H,24,25)(H2,21,22,23) |
| InChIKey | PBGIKXKKWWMAEV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |