C23H30BrNO — CID 69058945
2-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-diphenylethanol bromide (PubChem CID 69058945) has the molecular formula C23H30BrNO and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-diphenylethanol bromide.
| Compound Name | 2-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-diphenylethanol bromide |
|---|---|
| PubChem CID | 69058945 |
| Molecular Formula | C23H30BrNO |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl]-1,1-diphenylethanol bromide |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(CC(O)(c1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C23H30NO.BrH/c1-24(2)21-13-14-22(24)16-18(15-21)17-23(25,19-9-5-3-6-10-19)20-11-7-4-8-12-20;/h3-12,18,21-22,25H,13-17H2,1-2H3;1H/q+1;/p-1/t18?,21-,22+; |
| InChIKey | NULNJXKOSLKYAG-ODSDSRAWSA-M |
| XLogP | 1.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|