C25H28ClN5O5S — CID 69058978
3-[(2-amino-7H-purin-6-yl)sulfanyl]-6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione (PubChem CID 69058978) has the molecular formula C25H28ClN5O5S and a molecular weight of 546.05 g/mol. Its IUPAC name is 3-[(2-amino-7H-purin-6-yl)sulfanyl]-6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione.
| Compound Name | 3-[(2-amino-7H-purin-6-yl)sulfanyl]-6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
|---|---|
| PubChem CID | 69058978 |
| Molecular Formula | C25H28ClN5O5S |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 3-[(2-amino-7H-purin-6-yl)sulfanyl]-6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Sc3nc(N)nc4nc[nH]c34)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C25H28ClN5O5S/c1-34-17-10-18(35-2)15(26)9-13(17)7-8-25(14-5-3-4-6-14)11-16(32)20(23(33)36-25)37-22-19-21(29-12-28-19)30-24(27)31-22/h9-10,12,14,20H,3-8,11H2,1-2H3,(H3,27,28,29,30,31) |
| InChIKey | KSMZWDVEIZCMCB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|