About 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine
5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 69059021) has the molecular formula C14H10F3N5O
and a molecular weight of 321.26 g/mol. Its IUPAC name is 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| PubChem CID | 69059021 |
| Molecular Formula | C14H10F3N5O |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cc(-c3ncco3)cc(C(F)(F)F)c2)c(N)n1 |
| InChI | InChI=1S/C14H10F3N5O/c15-14(16,17)9-4-7(10-6-21-13(19)22-11(10)18)3-8(5-9)12-20-1-2-23-12/h1-6H,(H4,18,19,21,22) |
| InChIKey | JKPHXHRQHKJXCW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine?
The IUPAC name of 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (CID 69059021) is 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine is Nc1ncc(-c2cc(-c3ncco3)cc(C(F)(F)F)c2)c(N)n1.
What is the InChIKey of 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine?
The InChIKey is JKPHXHRQHKJXCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N5O/c15-14(16,17)9-4-7(10-6-21-13(19)22-11(10)18)3-8(5-9)12-20-1-2-23-12/h1-6H,(H4,18,19,21,22).
What are the key properties of 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine?
5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine has a molecular weight of 321.26 g/mol, XLogP of 2.98, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1,3-oxazol-2-yl)-5-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 69059021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).